C22H34O3 — CID 89484678
1-cyclohex-2-en-1-ylethyl 2-[(4S)-4-(2,2-dimethylbutyl)cyclohexa-1,5-dien-1-yl]oxyacetate (PubChem CID 89484678) has the molecular formula C22H34O3 and a molecular weight of 346.51 g/mol. Its IUPAC name is 1-cyclohex-2-en-1-ylethyl 2-[(4S)-4-(2,2-dimethylbutyl)cyclohexa-1,5-dien-1-yl]oxyacetate.
| Compound Name | 1-cyclohex-2-en-1-ylethyl 2-[(4S)-4-(2,2-dimethylbutyl)cyclohexa-1,5-dien-1-yl]oxyacetate |
|---|---|
| PubChem CID | 89484678 |
| Molecular Formula | C22H34O3 |
| Molecular Weight | 346.51 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | 1-cyclohex-2-en-1-ylethyl 2-[(4S)-4-(2,2-dimethylbutyl)cyclohexa-1,5-dien-1-yl]oxyacetate |
| SMILES | CCC(C)(C)C[C@H]1C=CC(OCC(=O)OC(C)C2C=CCCC2)=CC1 |
| InChI | InChI=1S/C22H34O3/c1-5-22(3,4)15-18-11-13-20(14-12-18)24-16-21(23)25-17(2)19-9-7-6-8-10-19/h7,9,11,13-14,17-19H,5-6,8,10,12,15-16H2,1-4H3/t17?,18-,19?/m0/s1 |
| InChIKey | NXKYHAFXLJATPY-XBMUEBEBSA-N |
| XLogP | 5.58 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.51 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|