About 3-[2-(1,3-dioxo-2-benzofuran-5-yl)propan-2-yl]benzoic acid
3-[2-(1,3-dioxo-2-benzofuran-5-yl)propan-2-yl]benzoic acid (PubChem CID 89484684) has the molecular formula C18H14O5
and a molecular weight of 310.31 g/mol. Its IUPAC name is 3-[2-(1,3-dioxo-2-benzofuran-5-yl)propan-2-yl]benzoic acid.
Molecular Properties
| Compound Name | 3-[2-(1,3-dioxo-2-benzofuran-5-yl)propan-2-yl]benzoic acid |
| PubChem CID | 89484684 |
| Molecular Formula | C18H14O5 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 3-[2-(1,3-dioxo-2-benzofuran-5-yl)propan-2-yl]benzoic acid |
| SMILES | CC(C)(c1cccc(C(=O)O)c1)c1ccc2c(c1)C(=O)OC2=O |
| InChI | InChI=1S/C18H14O5/c1-18(2,11-5-3-4-10(8-11)15(19)20)12-6-7-13-14(9-12)17(22)23-16(13)21/h3-9H,1-2H3,(H,19,20) |
| InChIKey | VPZNSYGRLUKYIG-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-(1,3-dioxo-2-benzofuran-5-yl)propan-2-yl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(1,3-dioxo-2-benzofuran-5-yl)propan-2-yl]benzoic acid?
The IUPAC name of 3-[2-(1,3-dioxo-2-benzofuran-5-yl)propan-2-yl]benzoic acid (CID 89484684) is 3-[2-(1,3-dioxo-2-benzofuran-5-yl)propan-2-yl]benzoic acid.
What is the SMILES notation for 3-[2-(1,3-dioxo-2-benzofuran-5-yl)propan-2-yl]benzoic acid?
The canonical SMILES for 3-[2-(1,3-dioxo-2-benzofuran-5-yl)propan-2-yl]benzoic acid is CC(C)(c1cccc(C(=O)O)c1)c1ccc2c(c1)C(=O)OC2=O.
What is the InChIKey of 3-[2-(1,3-dioxo-2-benzofuran-5-yl)propan-2-yl]benzoic acid?
The InChIKey is VPZNSYGRLUKYIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14O5/c1-18(2,11-5-3-4-10(8-11)15(19)20)12-6-7-13-14(9-12)17(22)23-16(13)21/h3-9H,1-2H3,(H,19,20).
What are the key properties of 3-[2-(1,3-dioxo-2-benzofuran-5-yl)propan-2-yl]benzoic acid?
3-[2-(1,3-dioxo-2-benzofuran-5-yl)propan-2-yl]benzoic acid has a molecular weight of 310.31 g/mol, XLogP of 3.02, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(1,3-dioxo-2-benzofuran-5-yl)propan-2-yl]benzoic acid is sourced from PubChem (CID 89484684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).