About (1-methylcyclopentyl) 2-(5-ethylcyclohexa-2,4-dien-1-yl)oxyacetate
(1-methylcyclopentyl) 2-(5-ethylcyclohexa-2,4-dien-1-yl)oxyacetate (PubChem CID 89484798) has the molecular formula C16H24O3
and a molecular weight of 264.37 g/mol. Its IUPAC name is (1-methylcyclopentyl) 2-(5-ethylcyclohexa-2,4-dien-1-yl)oxyacetate.
Molecular Properties
| Compound Name | (1-methylcyclopentyl) 2-(5-ethylcyclohexa-2,4-dien-1-yl)oxyacetate |
| PubChem CID | 89484798 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | (1-methylcyclopentyl) 2-(5-ethylcyclohexa-2,4-dien-1-yl)oxyacetate |
| SMILES | CCC1=CC=CC(OCC(=O)OC2(C)CCCC2)C1 |
| InChI | InChI=1S/C16H24O3/c1-3-13-7-6-8-14(11-13)18-12-15(17)19-16(2)9-4-5-10-16/h6-8,14H,3-5,9-12H2,1-2H3 |
| InChIKey | UQQFPDCNCIIKBT-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1-methylcyclopentyl) 2-(5-ethylcyclohexa-2,4-dien-1-yl)oxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methylcyclopentyl) 2-(5-ethylcyclohexa-2,4-dien-1-yl)oxyacetate?
The IUPAC name of (1-methylcyclopentyl) 2-(5-ethylcyclohexa-2,4-dien-1-yl)oxyacetate (CID 89484798) is (1-methylcyclopentyl) 2-(5-ethylcyclohexa-2,4-dien-1-yl)oxyacetate.
What is the SMILES notation for (1-methylcyclopentyl) 2-(5-ethylcyclohexa-2,4-dien-1-yl)oxyacetate?
The canonical SMILES for (1-methylcyclopentyl) 2-(5-ethylcyclohexa-2,4-dien-1-yl)oxyacetate is CCC1=CC=CC(OCC(=O)OC2(C)CCCC2)C1.
What is the InChIKey of (1-methylcyclopentyl) 2-(5-ethylcyclohexa-2,4-dien-1-yl)oxyacetate?
The InChIKey is UQQFPDCNCIIKBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24O3/c1-3-13-7-6-8-14(11-13)18-12-15(17)19-16(2)9-4-5-10-16/h6-8,14H,3-5,9-12H2,1-2H3.
What are the key properties of (1-methylcyclopentyl) 2-(5-ethylcyclohexa-2,4-dien-1-yl)oxyacetate?
(1-methylcyclopentyl) 2-(5-ethylcyclohexa-2,4-dien-1-yl)oxyacetate has a molecular weight of 264.37 g/mol, XLogP of 3.54, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methylcyclopentyl) 2-(5-ethylcyclohexa-2,4-dien-1-yl)oxyacetate is sourced from PubChem (CID 89484798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).