About 5-(4-phenoxyphenyl)-3,4-dihydro-2H-1,4-oxazine
5-(4-phenoxyphenyl)-3,4-dihydro-2H-1,4-oxazine (PubChem CID 89484982) has the molecular formula C16H15NO2
and a molecular weight of 253.30 g/mol. Its IUPAC name is 5-(4-phenoxyphenyl)-3,4-dihydro-2H-1,4-oxazine.
Molecular Properties
| Compound Name | 5-(4-phenoxyphenyl)-3,4-dihydro-2H-1,4-oxazine |
| PubChem CID | 89484982 |
| Molecular Formula | C16H15NO2 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 5-(4-phenoxyphenyl)-3,4-dihydro-2H-1,4-oxazine |
| SMILES | C1=C(c2ccc(Oc3ccccc3)cc2)NCCO1 |
| InChI | InChI=1S/C16H15NO2/c1-2-4-14(5-3-1)19-15-8-6-13(7-9-15)16-12-18-11-10-17-16/h1-9,12,17H,10-11H2 |
| InChIKey | RKLLYUTVETXRII-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(4-phenoxyphenyl)-3,4-dihydro-2H-1,4-oxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-phenoxyphenyl)-3,4-dihydro-2H-1,4-oxazine?
The IUPAC name of 5-(4-phenoxyphenyl)-3,4-dihydro-2H-1,4-oxazine (CID 89484982) is 5-(4-phenoxyphenyl)-3,4-dihydro-2H-1,4-oxazine.
What is the SMILES notation for 5-(4-phenoxyphenyl)-3,4-dihydro-2H-1,4-oxazine?
The canonical SMILES for 5-(4-phenoxyphenyl)-3,4-dihydro-2H-1,4-oxazine is C1=C(c2ccc(Oc3ccccc3)cc2)NCCO1.
What is the InChIKey of 5-(4-phenoxyphenyl)-3,4-dihydro-2H-1,4-oxazine?
The InChIKey is RKLLYUTVETXRII-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15NO2/c1-2-4-14(5-3-1)19-15-8-6-13(7-9-15)16-12-18-11-10-17-16/h1-9,12,17H,10-11H2.
What are the key properties of 5-(4-phenoxyphenyl)-3,4-dihydro-2H-1,4-oxazine?
5-(4-phenoxyphenyl)-3,4-dihydro-2H-1,4-oxazine has a molecular weight of 253.30 g/mol, XLogP of 3.40, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-phenoxyphenyl)-3,4-dihydro-2H-1,4-oxazine is sourced from PubChem (CID 89484982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).