C26H30Cl2N2O2S2 — CID 89485175
(5E)-5-[[3-(3-aminopentyl)-5-(4-chlorophenyl)furan-2-yl]methylidene]-3-(2-bicyclo[2.2.1]heptanyl)-2-sulfanylidene-1,3-thiazolidin-4-one;hydrochloride (PubChem CID 89485175) has the molecular formula C26H30Cl2N2O2S2 and a molecular weight of 537.58 g/mol. Its IUPAC name is (5E)-5-[[3-(3-aminopentyl)-5-(4-chlorophenyl)furan-2-yl]methylidene]-3-(2-bicyclo[2.2.1]heptanyl)-2-sulfanylidene-1,3-thiazolidin-4-one;hydrochloride.
| Compound Name | (5E)-5-[[3-(3-aminopentyl)-5-(4-chlorophenyl)furan-2-yl]methylidene]-3-(2-bicyclo[2.2.1]heptanyl)-2-sulfanylidene-1,3-thiazolidin-4-one;hydrochloride |
|---|---|
| PubChem CID | 89485175 |
| Molecular Formula | C26H30Cl2N2O2S2 |
| Molecular Weight | 537.58 g/mol |
| Exact Mass | 536.11 |
| IUPAC Name | (5E)-5-[[3-(3-aminopentyl)-5-(4-chlorophenyl)furan-2-yl]methylidene]-3-(2-bicyclo[2.2.1]heptanyl)-2-sulfanylidene-1,3-thiazolidin-4-one;hydrochloride |
| SMILES | CCC(N)CCc1cc(-c2ccc(Cl)cc2)oc1/C=C1/SC(=S)N(C2CC3CCC2C3)C1=O.Cl |
| InChI | InChI=1S/C26H29ClN2O2S2.ClH/c1-2-20(28)10-7-18-13-22(16-5-8-19(27)9-6-16)31-23(18)14-24-25(30)29(26(32)33-24)21-12-15-3-4-17(21)11-15;/h5-6,8-9,13-15,17,20-21H,2-4,7,10-12,28H2,1H3;1H/b24-14+; |
| InChIKey | IMPUUUTWQNCDLG-SXMBIPSUSA-N |
| XLogP | 7.08 |
| TPSA | 59.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.58 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|