C31H40N4O2S2 — CID 89485381
(5Z)-3-(2-bicyclo[2.2.1]heptanyl)-5-[[5-(3-methoxyphenyl)-3-(5-piperazin-1-ylpentyl)-1H-pyrrol-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 89485381) has the molecular formula C31H40N4O2S2 and a molecular weight of 564.82 g/mol. Its IUPAC name is (5Z)-3-(2-bicyclo[2.2.1]heptanyl)-5-[[5-(3-methoxyphenyl)-3-(5-piperazin-1-ylpentyl)-1H-pyrrol-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-(2-bicyclo[2.2.1]heptanyl)-5-[[5-(3-methoxyphenyl)-3-(5-piperazin-1-ylpentyl)-1H-pyrrol-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 89485381 |
| Molecular Formula | C31H40N4O2S2 |
| Molecular Weight | 564.82 g/mol |
| Exact Mass | 564.26 |
| IUPAC Name | (5Z)-3-(2-bicyclo[2.2.1]heptanyl)-5-[[5-(3-methoxyphenyl)-3-(5-piperazin-1-ylpentyl)-1H-pyrrol-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | COc1cccc(-c2cc(CCCCCN3CCNCC3)c(/C=C3\SC(=S)N(C4CC5CCC4C5)C3=O)[nH]2)c1 |
| InChI | InChI=1S/C31H40N4O2S2/c1-37-25-8-5-7-22(18-25)26-19-23(6-3-2-4-13-34-14-11-32-12-15-34)27(33-26)20-29-30(36)35(31(38)39-29)28-17-21-9-10-24(28)16-21/h5,7-8,18-21,24,28,32-33H,2-4,6,9-17H2,1H3/b29-20- |
| InChIKey | ZXBRGWOQMKULOV-BRPDVVIDSA-N |
| XLogP | 5.70 |
| TPSA | 60.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.82 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|