C17H16N4O — CID 89485573
2-azabicyclo[2.2.0]hexa-1,3,5-triene;1-(2-ethynyl-3-pyridinyl)-4,4-dimethylimidazolidin-2-one (PubChem CID 89485573) has the molecular formula C17H16N4O and a molecular weight of 292.34 g/mol. Its IUPAC name is 2-azabicyclo[2.2.0]hexa-1,3,5-triene;1-(2-ethynyl-3-pyridinyl)-4,4-dimethylimidazolidin-2-one.
| Compound Name | 2-azabicyclo[2.2.0]hexa-1,3,5-triene;1-(2-ethynyl-3-pyridinyl)-4,4-dimethylimidazolidin-2-one |
|---|---|
| PubChem CID | 89485573 |
| Molecular Formula | C17H16N4O |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 2-azabicyclo[2.2.0]hexa-1,3,5-triene;1-(2-ethynyl-3-pyridinyl)-4,4-dimethylimidazolidin-2-one |
| SMILES | C#Cc1ncccc1N1CC(C)(C)NC1=O.c1cc2ncc1-2 |
| InChI | InChI=1S/C12H13N3O.C5H3N/c1-4-9-10(6-5-7-13-9)15-8-12(2,3)14-11(15)16;1-2-5-4(1)3-6-5/h1,5-7H,8H2,2-3H3,(H,14,16);1-3H |
| InChIKey | CNDBQSLOKWBIFR-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|