C18H18F3N7O2 — CID 89486065
N-[1-(2,2-difluoroethyl)piperidin-4-yl]-2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-5-nitropyrimidin-4-amine (PubChem CID 89486065) has the molecular formula C18H18F3N7O2 and a molecular weight of 421.38 g/mol. Its IUPAC name is N-[1-(2,2-difluoroethyl)piperidin-4-yl]-2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-5-nitropyrimidin-4-amine.
| Compound Name | N-[1-(2,2-difluoroethyl)piperidin-4-yl]-2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 89486065 |
| Molecular Formula | C18H18F3N7O2 |
| Molecular Weight | 421.38 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | N-[1-(2,2-difluoroethyl)piperidin-4-yl]-2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-5-nitropyrimidin-4-amine |
| SMILES | O=[N+]([O-])c1cnc(-c2cnc3ccc(F)cn23)nc1NC1CCN(CC(F)F)CC1 |
| InChI | InChI=1S/C18H18F3N7O2/c19-11-1-2-16-22-7-13(27(16)9-11)17-23-8-14(28(29)30)18(25-17)24-12-3-5-26(6-4-12)10-15(20)21/h1-2,7-9,12,15H,3-6,10H2,(H,23,24,25) |
| InChIKey | OOIONPQGJBLETB-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.38 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|