About (3-amino-1,1-difluoropropan-2-yl)carbamic acid
(3-amino-1,1-difluoropropan-2-yl)carbamic acid (PubChem CID 89486798) has the molecular formula C4H8F2N2O2
and a molecular weight of 154.12 g/mol. Its IUPAC name is (3-amino-1,1-difluoropropan-2-yl)carbamic acid.
Molecular Properties
| Compound Name | (3-amino-1,1-difluoropropan-2-yl)carbamic acid |
| PubChem CID | 89486798 |
| Molecular Formula | C4H8F2N2O2 |
| Molecular Weight | 154.12 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | (3-amino-1,1-difluoropropan-2-yl)carbamic acid |
| SMILES | NCC(NC(=O)O)C(F)F |
| InChI | InChI=1S/C4H8F2N2O2/c5-3(6)2(1-7)8-4(9)10/h2-3,8H,1,7H2,(H,9,10) |
| InChIKey | ZNUZJDNPYMYOEU-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.12 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3-amino-1,1-difluoropropan-2-yl)carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-amino-1,1-difluoropropan-2-yl)carbamic acid?
The IUPAC name of (3-amino-1,1-difluoropropan-2-yl)carbamic acid (CID 89486798) is (3-amino-1,1-difluoropropan-2-yl)carbamic acid.
What is the SMILES notation for (3-amino-1,1-difluoropropan-2-yl)carbamic acid?
The canonical SMILES for (3-amino-1,1-difluoropropan-2-yl)carbamic acid is NCC(NC(=O)O)C(F)F.
What is the InChIKey of (3-amino-1,1-difluoropropan-2-yl)carbamic acid?
The InChIKey is ZNUZJDNPYMYOEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8F2N2O2/c5-3(6)2(1-7)8-4(9)10/h2-3,8H,1,7H2,(H,9,10).
What are the key properties of (3-amino-1,1-difluoropropan-2-yl)carbamic acid?
(3-amino-1,1-difluoropropan-2-yl)carbamic acid has a molecular weight of 154.12 g/mol, XLogP of -0.15, 3 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3-amino-1,1-difluoropropan-2-yl)carbamic acid is sourced from PubChem (CID 89486798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).