C10H14N8O5 — CID 89486880
2-amino-2-azido-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,8-dihydropurin-6-one (PubChem CID 89486880) has the molecular formula C10H14N8O5 and a molecular weight of 326.27 g/mol. Its IUPAC name is 2-amino-2-azido-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,8-dihydropurin-6-one.
| Compound Name | 2-amino-2-azido-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,8-dihydropurin-6-one |
|---|---|
| PubChem CID | 89486880 |
| Molecular Formula | C10H14N8O5 |
| Molecular Weight | 326.27 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 2-amino-2-azido-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,8-dihydropurin-6-one |
| SMILES | [N-]=[N+]=NC1(N)N=C2C(=NCN2[C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)C(=O)N1 |
| InChI | InChI=1S/C10H14N8O5/c11-10(16-17-12)14-7-4(8(22)15-10)13-2-18(7)9-6(21)5(20)3(1-19)23-9/h3,5-6,9,19-21H,1-2,11H2,(H,15,22)/t3-,5-,6-,9-,10?/m1/s1 |
| InChIKey | SHVBZUYUOFERJQ-RVISBKTGSA-N |
| XLogP | -3.45 |
| TPSA | 201.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.27 |
| LogP ≤ 5 | -3.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|