(2-amino-3,3,3-trifluoropropyl)carbamic acid

C4H7F3N2O2 — CID 89486925

IUPAC(2-amino-3,3,3-trifluoropropyl)carbamic acid
SMILESNC(CNC(=O)O)C(F)(F)F
InChIInChI=1S/C4H7F3N2O2/c5-4(6,7)2(8)1-9-3(10)11/h2,9H,1,8H2,(H,10,11)
InChIKeyHEYGNIJWOLZWMV-UHFFFAOYSA-N
MW172.11 g/mol
LogP0.14
Rot. Bonds2

About (2-amino-3,3,3-trifluoropropyl)carbamic acid

(2-amino-3,3,3-trifluoropropyl)carbamic acid (PubChem CID 89486925) has the molecular formula C4H7F3N2O2 and a molecular weight of 172.11 g/mol. Its IUPAC name is (2-amino-3,3,3-trifluoropropyl)carbamic acid.

Molecular Properties

Compound Name(2-amino-3,3,3-trifluoropropyl)carbamic acid
PubChem CID89486925
Molecular FormulaC4H7F3N2O2
Molecular Weight172.11 g/mol
Exact Mass172.05
IUPAC Name(2-amino-3,3,3-trifluoropropyl)carbamic acid
SMILESNC(CNC(=O)O)C(F)(F)F
InChIInChI=1S/C4H7F3N2O2/c5-4(6,7)2(8)1-9-3(10)11/h2,9H,1,8H2,(H,10,11)
InChIKeyHEYGNIJWOLZWMV-UHFFFAOYSA-N
XLogP0.14
TPSA75.35 Ų
H-Bond Donors3
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500172.11
LogP ≤ 50.14
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 102

Analyze (2-amino-3,3,3-trifluoropropyl)carbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2-amino-3,3,3-trifluoropropyl)carbamic acid?
The IUPAC name of (2-amino-3,3,3-trifluoropropyl)carbamic acid (CID 89486925) is (2-amino-3,3,3-trifluoropropyl)carbamic acid.
What is the SMILES notation for (2-amino-3,3,3-trifluoropropyl)carbamic acid?
The canonical SMILES for (2-amino-3,3,3-trifluoropropyl)carbamic acid is NC(CNC(=O)O)C(F)(F)F.
What is the InChIKey of (2-amino-3,3,3-trifluoropropyl)carbamic acid?
The InChIKey is HEYGNIJWOLZWMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7F3N2O2/c5-4(6,7)2(8)1-9-3(10)11/h2,9H,1,8H2,(H,10,11).
What are the key properties of (2-amino-3,3,3-trifluoropropyl)carbamic acid?
(2-amino-3,3,3-trifluoropropyl)carbamic acid has a molecular weight of 172.11 g/mol, XLogP of 0.14, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-amino-3,3,3-trifluoropropyl)carbamic acid is sourced from PubChem (CID 89486925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).