C28H23F2N5OS — CID 89486930
6-(5-fluoro-1,4,5,6-tetrahydropyrimidin-2-yl)-2-[5-[6-(5-fluoro-1,4,5,6-tetrahydropyrimidin-2-yl)-1-benzofuran-2-yl]thiophen-2-yl]-1H-indole (PubChem CID 89486930) has the molecular formula C28H23F2N5OS and a molecular weight of 515.59 g/mol. Its IUPAC name is 6-(5-fluoro-1,4,5,6-tetrahydropyrimidin-2-yl)-2-[5-[6-(5-fluoro-1,4,5,6-tetrahydropyrimidin-2-yl)-1-benzofuran-2-yl]thiophen-2-yl]-1H-indole.
| Compound Name | 6-(5-fluoro-1,4,5,6-tetrahydropyrimidin-2-yl)-2-[5-[6-(5-fluoro-1,4,5,6-tetrahydropyrimidin-2-yl)-1-benzofuran-2-yl]thiophen-2-yl]-1H-indole |
|---|---|
| PubChem CID | 89486930 |
| Molecular Formula | C28H23F2N5OS |
| Molecular Weight | 515.59 g/mol |
| Exact Mass | 515.16 |
| IUPAC Name | 6-(5-fluoro-1,4,5,6-tetrahydropyrimidin-2-yl)-2-[5-[6-(5-fluoro-1,4,5,6-tetrahydropyrimidin-2-yl)-1-benzofuran-2-yl]thiophen-2-yl]-1H-indole |
| SMILES | FC1CN=C(c2ccc3cc(-c4ccc(-c5cc6ccc(C7=NCC(F)CN7)cc6o5)s4)[nH]c3c2)NC1 |
| InChI | InChI=1S/C28H23F2N5OS/c29-19-11-31-27(32-12-19)17-3-1-15-7-22(35-21(15)8-17)25-5-6-26(37-25)24-9-16-2-4-18(10-23(16)36-24)28-33-13-20(30)14-34-28/h1-10,19-20,35H,11-14H2,(H,31,32)(H,33,34) |
| InChIKey | LXNPUYHFEXOYGF-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 77.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.59 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |