About 2,4-dichloro-5-methyl-5,7-dihydrothieno[3,4-d]pyrimidine
2,4-dichloro-5-methyl-5,7-dihydrothieno[3,4-d]pyrimidine (PubChem CID 89487293) has the molecular formula C7H6Cl2N2S
and a molecular weight of 221.11 g/mol. Its IUPAC name is 2,4-dichloro-5-methyl-5,7-dihydrothieno[3,4-d]pyrimidine.
Molecular Properties
| Compound Name | 2,4-dichloro-5-methyl-5,7-dihydrothieno[3,4-d]pyrimidine |
| PubChem CID | 89487293 |
| Molecular Formula | C7H6Cl2N2S |
| Molecular Weight | 221.11 g/mol |
| Exact Mass | 219.96 |
| IUPAC Name | 2,4-dichloro-5-methyl-5,7-dihydrothieno[3,4-d]pyrimidine |
| SMILES | CC1SCc2nc(Cl)nc(Cl)c21 |
| InChI | InChI=1S/C7H6Cl2N2S/c1-3-5-4(2-12-3)10-7(9)11-6(5)8/h3H,2H2,1H3 |
| InChIKey | QYPYZSRTCKTHKP-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.11 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,4-dichloro-5-methyl-5,7-dihydrothieno[3,4-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dichloro-5-methyl-5,7-dihydrothieno[3,4-d]pyrimidine?
The IUPAC name of 2,4-dichloro-5-methyl-5,7-dihydrothieno[3,4-d]pyrimidine (CID 89487293) is 2,4-dichloro-5-methyl-5,7-dihydrothieno[3,4-d]pyrimidine.
What is the SMILES notation for 2,4-dichloro-5-methyl-5,7-dihydrothieno[3,4-d]pyrimidine?
The canonical SMILES for 2,4-dichloro-5-methyl-5,7-dihydrothieno[3,4-d]pyrimidine is CC1SCc2nc(Cl)nc(Cl)c21.
What is the InChIKey of 2,4-dichloro-5-methyl-5,7-dihydrothieno[3,4-d]pyrimidine?
The InChIKey is QYPYZSRTCKTHKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6Cl2N2S/c1-3-5-4(2-12-3)10-7(9)11-6(5)8/h3H,2H2,1H3.
What are the key properties of 2,4-dichloro-5-methyl-5,7-dihydrothieno[3,4-d]pyrimidine?
2,4-dichloro-5-methyl-5,7-dihydrothieno[3,4-d]pyrimidine has a molecular weight of 221.11 g/mol, XLogP of 3.09, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dichloro-5-methyl-5,7-dihydrothieno[3,4-d]pyrimidine is sourced from PubChem (CID 89487293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).