About (2S)-2-pyrrol-1-ylbutane-1,4-diol
(2S)-2-pyrrol-1-ylbutane-1,4-diol (PubChem CID 89487374) has the molecular formula C8H13NO2
and a molecular weight of 155.20 g/mol. Its IUPAC name is (2S)-2-pyrrol-1-ylbutane-1,4-diol.
Molecular Properties
| Compound Name | (2S)-2-pyrrol-1-ylbutane-1,4-diol |
| PubChem CID | 89487374 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | (2S)-2-pyrrol-1-ylbutane-1,4-diol |
| SMILES | OCC[C@@H](CO)n1cccc1 |
| InChI | InChI=1S/C8H13NO2/c10-6-3-8(7-11)9-4-1-2-5-9/h1-2,4-5,8,10-11H,3,6-7H2/t8-/m0/s1 |
| InChIKey | ZQRYTXFWLLSCSD-QMMMGPOBSA-N |
| XLogP | 0.40 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-2-pyrrol-1-ylbutane-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-pyrrol-1-ylbutane-1,4-diol?
The IUPAC name of (2S)-2-pyrrol-1-ylbutane-1,4-diol (CID 89487374) is (2S)-2-pyrrol-1-ylbutane-1,4-diol.
What is the SMILES notation for (2S)-2-pyrrol-1-ylbutane-1,4-diol?
The canonical SMILES for (2S)-2-pyrrol-1-ylbutane-1,4-diol is OCC[C@@H](CO)n1cccc1.
What is the InChIKey of (2S)-2-pyrrol-1-ylbutane-1,4-diol?
The InChIKey is ZQRYTXFWLLSCSD-QMMMGPOBSA-N. The full InChI is InChI=1S/C8H13NO2/c10-6-3-8(7-11)9-4-1-2-5-9/h1-2,4-5,8,10-11H,3,6-7H2/t8-/m0/s1.
What are the key properties of (2S)-2-pyrrol-1-ylbutane-1,4-diol?
(2S)-2-pyrrol-1-ylbutane-1,4-diol has a molecular weight of 155.20 g/mol, XLogP of 0.40, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-pyrrol-1-ylbutane-1,4-diol is sourced from PubChem (CID 89487374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).