About 8-fluoro-N-(2,2,2-trifluoroethyl)quinazolin-4-amine
8-fluoro-N-(2,2,2-trifluoroethyl)quinazolin-4-amine (PubChem CID 89487428) has the molecular formula C10H7F4N3
and a molecular weight of 245.18 g/mol. Its IUPAC name is 8-fluoro-N-(2,2,2-trifluoroethyl)quinazolin-4-amine.
Molecular Properties
| Compound Name | 8-fluoro-N-(2,2,2-trifluoroethyl)quinazolin-4-amine |
| PubChem CID | 89487428 |
| Molecular Formula | C10H7F4N3 |
| Molecular Weight | 245.18 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | 8-fluoro-N-(2,2,2-trifluoroethyl)quinazolin-4-amine |
| SMILES | Fc1cccc2c(NCC(F)(F)F)ncnc12 |
| InChI | InChI=1S/C10H7F4N3/c11-7-3-1-2-6-8(7)16-5-17-9(6)15-4-10(12,13)14/h1-3,5H,4H2,(H,15,16,17) |
| InChIKey | REKWPHYHCDKAPZ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.18 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-fluoro-N-(2,2,2-trifluoroethyl)quinazolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-fluoro-N-(2,2,2-trifluoroethyl)quinazolin-4-amine?
The IUPAC name of 8-fluoro-N-(2,2,2-trifluoroethyl)quinazolin-4-amine (CID 89487428) is 8-fluoro-N-(2,2,2-trifluoroethyl)quinazolin-4-amine.
What is the SMILES notation for 8-fluoro-N-(2,2,2-trifluoroethyl)quinazolin-4-amine?
The canonical SMILES for 8-fluoro-N-(2,2,2-trifluoroethyl)quinazolin-4-amine is Fc1cccc2c(NCC(F)(F)F)ncnc12.
What is the InChIKey of 8-fluoro-N-(2,2,2-trifluoroethyl)quinazolin-4-amine?
The InChIKey is REKWPHYHCDKAPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7F4N3/c11-7-3-1-2-6-8(7)16-5-17-9(6)15-4-10(12,13)14/h1-3,5H,4H2,(H,15,16,17).
What are the key properties of 8-fluoro-N-(2,2,2-trifluoroethyl)quinazolin-4-amine?
8-fluoro-N-(2,2,2-trifluoroethyl)quinazolin-4-amine has a molecular weight of 245.18 g/mol, XLogP of 2.74, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-fluoro-N-(2,2,2-trifluoroethyl)quinazolin-4-amine is sourced from PubChem (CID 89487428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).