C29H28F2N6O4 — CID 89487568
2-[2-[2-[1-[(4-ethoxy-2,6-difluorophenyl)methyl]indazol-3-yl]-4-(pyridin-4-ylamino)pyrimidin-5-yl]oxyethoxy]ethanol (PubChem CID 89487568) has the molecular formula C29H28F2N6O4 and a molecular weight of 562.58 g/mol. Its IUPAC name is 2-[2-[2-[1-[(4-ethoxy-2,6-difluorophenyl)methyl]indazol-3-yl]-4-(pyridin-4-ylamino)pyrimidin-5-yl]oxyethoxy]ethanol.
| Compound Name | 2-[2-[2-[1-[(4-ethoxy-2,6-difluorophenyl)methyl]indazol-3-yl]-4-(pyridin-4-ylamino)pyrimidin-5-yl]oxyethoxy]ethanol |
|---|---|
| PubChem CID | 89487568 |
| Molecular Formula | C29H28F2N6O4 |
| Molecular Weight | 562.58 g/mol |
| Exact Mass | 562.21 |
| IUPAC Name | 2-[2-[2-[1-[(4-ethoxy-2,6-difluorophenyl)methyl]indazol-3-yl]-4-(pyridin-4-ylamino)pyrimidin-5-yl]oxyethoxy]ethanol |
| SMILES | CCOc1cc(F)c(Cn2nc(-c3ncc(OCCOCCO)c(Nc4ccncc4)n3)c3ccccc32)c(F)c1 |
| InChI | InChI=1S/C29H28F2N6O4/c1-2-40-20-15-23(30)22(24(31)16-20)18-37-25-6-4-3-5-21(25)27(36-37)29-33-17-26(41-14-13-39-12-11-38)28(35-29)34-19-7-9-32-10-8-19/h3-10,15-17,38H,2,11-14,18H2,1H3,(H,32,33,34,35) |
| InChIKey | BYGQZPGVGFAQKB-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 116.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.58 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|