C20H29N5O3 — CID 89487659
[1-(6-carbamoyl-3-pyridinyl)piperidin-4-yl] 4-cyclobutylpiperazine-1-carboxylate (PubChem CID 89487659) has the molecular formula C20H29N5O3 and a molecular weight of 387.48 g/mol. Its IUPAC name is [1-(6-carbamoyl-3-pyridinyl)piperidin-4-yl] 4-cyclobutylpiperazine-1-carboxylate.
| Compound Name | [1-(6-carbamoyl-3-pyridinyl)piperidin-4-yl] 4-cyclobutylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 89487659 |
| Molecular Formula | C20H29N5O3 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | [1-(6-carbamoyl-3-pyridinyl)piperidin-4-yl] 4-cyclobutylpiperazine-1-carboxylate |
| SMILES | NC(=O)c1ccc(N2CCC(OC(=O)N3CCN(C4CCC4)CC3)CC2)cn1 |
| InChI | InChI=1S/C20H29N5O3/c21-19(26)18-5-4-16(14-22-18)23-8-6-17(7-9-23)28-20(27)25-12-10-24(11-13-25)15-2-1-3-15/h4-5,14-15,17H,1-3,6-13H2,(H2,21,26) |
| InChIKey | BDDKTSMWABGWSY-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 92.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |