About [1-(1,3-thiazol-5-yl)piperidin-4-yl] 4-propan-2-ylpiperazine-1-carboxylate
[1-(1,3-thiazol-5-yl)piperidin-4-yl] 4-propan-2-ylpiperazine-1-carboxylate (PubChem CID 89487696) has the molecular formula C16H26N4O2S
and a molecular weight of 338.48 g/mol. Its IUPAC name is [1-(1,3-thiazol-5-yl)piperidin-4-yl] 4-propan-2-ylpiperazine-1-carboxylate.
Molecular Properties
| Compound Name | [1-(1,3-thiazol-5-yl)piperidin-4-yl] 4-propan-2-ylpiperazine-1-carboxylate |
| PubChem CID | 89487696 |
| Molecular Formula | C16H26N4O2S |
| Molecular Weight | 338.48 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | [1-(1,3-thiazol-5-yl)piperidin-4-yl] 4-propan-2-ylpiperazine-1-carboxylate |
| SMILES | CC(C)N1CCN(C(=O)OC2CCN(c3cncs3)CC2)CC1 |
| InChI | InChI=1S/C16H26N4O2S/c1-13(2)18-7-9-20(10-8-18)16(21)22-14-3-5-19(6-4-14)15-11-17-12-23-15/h11-14H,3-10H2,1-2H3 |
| InChIKey | IHTVRUMYBYHNAK-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 48.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.48 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [1-(1,3-thiazol-5-yl)piperidin-4-yl] 4-propan-2-ylpiperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(1,3-thiazol-5-yl)piperidin-4-yl] 4-propan-2-ylpiperazine-1-carboxylate?
The IUPAC name of [1-(1,3-thiazol-5-yl)piperidin-4-yl] 4-propan-2-ylpiperazine-1-carboxylate (CID 89487696) is [1-(1,3-thiazol-5-yl)piperidin-4-yl] 4-propan-2-ylpiperazine-1-carboxylate.
What is the SMILES notation for [1-(1,3-thiazol-5-yl)piperidin-4-yl] 4-propan-2-ylpiperazine-1-carboxylate?
The canonical SMILES for [1-(1,3-thiazol-5-yl)piperidin-4-yl] 4-propan-2-ylpiperazine-1-carboxylate is CC(C)N1CCN(C(=O)OC2CCN(c3cncs3)CC2)CC1.
What is the InChIKey of [1-(1,3-thiazol-5-yl)piperidin-4-yl] 4-propan-2-ylpiperazine-1-carboxylate?
The InChIKey is IHTVRUMYBYHNAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26N4O2S/c1-13(2)18-7-9-20(10-8-18)16(21)22-14-3-5-19(6-4-14)15-11-17-12-23-15/h11-14H,3-10H2,1-2H3.
What are the key properties of [1-(1,3-thiazol-5-yl)piperidin-4-yl] 4-propan-2-ylpiperazine-1-carboxylate?
[1-(1,3-thiazol-5-yl)piperidin-4-yl] 4-propan-2-ylpiperazine-1-carboxylate has a molecular weight of 338.48 g/mol, XLogP of 2.27, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(1,3-thiazol-5-yl)piperidin-4-yl] 4-propan-2-ylpiperazine-1-carboxylate is sourced from PubChem (CID 89487696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).