About 1H-indole-2,3-dione;methylsulfinylmethane
1H-indole-2,3-dione;methylsulfinylmethane (PubChem CID 89487830) has the molecular formula C10H11NO3S
and a molecular weight of 225.27 g/mol. Its IUPAC name is 1H-indole-2,3-dione;methylsulfinylmethane.
Molecular Properties
| Compound Name | 1H-indole-2,3-dione;methylsulfinylmethane |
| PubChem CID | 89487830 |
| Molecular Formula | C10H11NO3S |
| Molecular Weight | 225.27 g/mol |
| Exact Mass | 225.05 |
| IUPAC Name | 1H-indole-2,3-dione;methylsulfinylmethane |
| SMILES | CS(C)=O.O=C1Nc2ccccc2C1=O |
| InChI | InChI=1S/C8H5NO2.C2H6OS/c10-7-5-3-1-2-4-6(5)9-8(7)11;1-4(2)3/h1-4H,(H,9,10,11);1-2H3 |
| InChIKey | AEOVANKVABHANY-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.27 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 1H-indole-2,3-dione;methylsulfinylmethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indole-2,3-dione;methylsulfinylmethane?
The IUPAC name of 1H-indole-2,3-dione;methylsulfinylmethane (CID 89487830) is 1H-indole-2,3-dione;methylsulfinylmethane.
What is the SMILES notation for 1H-indole-2,3-dione;methylsulfinylmethane?
The canonical SMILES for 1H-indole-2,3-dione;methylsulfinylmethane is CS(C)=O.O=C1Nc2ccccc2C1=O.
What is the InChIKey of 1H-indole-2,3-dione;methylsulfinylmethane?
The InChIKey is AEOVANKVABHANY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5NO2.C2H6OS/c10-7-5-3-1-2-4-6(5)9-8(7)11;1-4(2)3/h1-4H,(H,9,10,11);1-2H3.
What are the key properties of 1H-indole-2,3-dione;methylsulfinylmethane?
1H-indole-2,3-dione;methylsulfinylmethane has a molecular weight of 225.27 g/mol, XLogP of 0.82, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indole-2,3-dione;methylsulfinylmethane is sourced from PubChem (CID 89487830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).