C19H28N4O2 — CID 89487896
(1-pyridin-4-ylpiperidin-4-yl) 4-cyclobutylpiperazine-1-carboxylate (PubChem CID 89487896) has the molecular formula C19H28N4O2 and a molecular weight of 344.46 g/mol. Its IUPAC name is (1-pyridin-4-ylpiperidin-4-yl) 4-cyclobutylpiperazine-1-carboxylate.
| Compound Name | (1-pyridin-4-ylpiperidin-4-yl) 4-cyclobutylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 89487896 |
| Molecular Formula | C19H28N4O2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | (1-pyridin-4-ylpiperidin-4-yl) 4-cyclobutylpiperazine-1-carboxylate |
| SMILES | O=C(OC1CCN(c2ccncc2)CC1)N1CCN(C2CCC2)CC1 |
| InChI | InChI=1S/C19H28N4O2/c24-19(23-14-12-22(13-15-23)16-2-1-3-16)25-18-6-10-21(11-7-18)17-4-8-20-9-5-17/h4-5,8-9,16,18H,1-3,6-7,10-15H2 |
| InChIKey | CIHWCEXJPAIFSO-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 48.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |