C14H13Cl2F2N5O6S — CID 89487907
N-[2,4-dichloro-5-[4-(difluoromethyl)-3-methyl-5-oxo-1,2,4-triazol-1-yl]phenyl]methanesulfonamide;1,3-oxazolidine-2,4-dione (PubChem CID 89487907) has the molecular formula C14H13Cl2F2N5O6S and a molecular weight of 488.26 g/mol. Its IUPAC name is N-[2,4-dichloro-5-[4-(difluoromethyl)-3-methyl-5-oxo-1,2,4-triazol-1-yl]phenyl]methanesulfonamide;1,3-oxazolidine-2,4-dione.
| Compound Name | N-[2,4-dichloro-5-[4-(difluoromethyl)-3-methyl-5-oxo-1,2,4-triazol-1-yl]phenyl]methanesulfonamide;1,3-oxazolidine-2,4-dione |
|---|---|
| PubChem CID | 89487907 |
| Molecular Formula | C14H13Cl2F2N5O6S |
| Molecular Weight | 488.26 g/mol |
| Exact Mass | 486.99 |
| IUPAC Name | N-[2,4-dichloro-5-[4-(difluoromethyl)-3-methyl-5-oxo-1,2,4-triazol-1-yl]phenyl]methanesulfonamide;1,3-oxazolidine-2,4-dione |
| SMILES | Cc1nn(-c2cc(NS(C)(=O)=O)c(Cl)cc2Cl)c(=O)n1C(F)F.O=C1COC(=O)N1 |
| InChI | InChI=1S/C11H10Cl2F2N4O3S.C3H3NO3/c1-5-16-19(11(20)18(5)10(14)15)9-4-8(17-23(2,21)22)6(12)3-7(9)13;5-2-1-7-3(6)4-2/h3-4,10,17H,1-2H3;1H2,(H,4,5,6) |
| InChIKey | DCLVTRIJODMXQU-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 141.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.26 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |