About [1-(5-methyl-1,3-thiazol-2-yl)piperidin-4-yl] 4-propan-2-ylpiperazine-1-carboxylate
[1-(5-methyl-1,3-thiazol-2-yl)piperidin-4-yl] 4-propan-2-ylpiperazine-1-carboxylate (PubChem CID 89487910) has the molecular formula C17H28N4O2S
and a molecular weight of 352.50 g/mol. Its IUPAC name is [1-(5-methyl-1,3-thiazol-2-yl)piperidin-4-yl] 4-propan-2-ylpiperazine-1-carboxylate.
Molecular Properties
| Compound Name | [1-(5-methyl-1,3-thiazol-2-yl)piperidin-4-yl] 4-propan-2-ylpiperazine-1-carboxylate |
| PubChem CID | 89487910 |
| Molecular Formula | C17H28N4O2S |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | [1-(5-methyl-1,3-thiazol-2-yl)piperidin-4-yl] 4-propan-2-ylpiperazine-1-carboxylate |
| SMILES | Cc1cnc(N2CCC(OC(=O)N3CCN(C(C)C)CC3)CC2)s1 |
| InChI | InChI=1S/C17H28N4O2S/c1-13(2)19-8-10-21(11-9-19)17(22)23-15-4-6-20(7-5-15)16-18-12-14(3)24-16/h12-13,15H,4-11H2,1-3H3 |
| InChIKey | YQZIOZGTUYUPIU-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 48.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [1-(5-methyl-1,3-thiazol-2-yl)piperidin-4-yl] 4-propan-2-ylpiperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(5-methyl-1,3-thiazol-2-yl)piperidin-4-yl] 4-propan-2-ylpiperazine-1-carboxylate?
The IUPAC name of [1-(5-methyl-1,3-thiazol-2-yl)piperidin-4-yl] 4-propan-2-ylpiperazine-1-carboxylate (CID 89487910) is [1-(5-methyl-1,3-thiazol-2-yl)piperidin-4-yl] 4-propan-2-ylpiperazine-1-carboxylate.
What is the SMILES notation for [1-(5-methyl-1,3-thiazol-2-yl)piperidin-4-yl] 4-propan-2-ylpiperazine-1-carboxylate?
The canonical SMILES for [1-(5-methyl-1,3-thiazol-2-yl)piperidin-4-yl] 4-propan-2-ylpiperazine-1-carboxylate is Cc1cnc(N2CCC(OC(=O)N3CCN(C(C)C)CC3)CC2)s1.
What is the InChIKey of [1-(5-methyl-1,3-thiazol-2-yl)piperidin-4-yl] 4-propan-2-ylpiperazine-1-carboxylate?
The InChIKey is YQZIOZGTUYUPIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28N4O2S/c1-13(2)19-8-10-21(11-9-19)17(22)23-15-4-6-20(7-5-15)16-18-12-14(3)24-16/h12-13,15H,4-11H2,1-3H3.
What are the key properties of [1-(5-methyl-1,3-thiazol-2-yl)piperidin-4-yl] 4-propan-2-ylpiperazine-1-carboxylate?
[1-(5-methyl-1,3-thiazol-2-yl)piperidin-4-yl] 4-propan-2-ylpiperazine-1-carboxylate has a molecular weight of 352.50 g/mol, XLogP of 2.58, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(5-methyl-1,3-thiazol-2-yl)piperidin-4-yl] 4-propan-2-ylpiperazine-1-carboxylate is sourced from PubChem (CID 89487910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).