About 4-[3,3-dimethyl-2-(3-oxobutyl)cyclobutyl]pent-4-enal
4-[3,3-dimethyl-2-(3-oxobutyl)cyclobutyl]pent-4-enal (PubChem CID 89488063) has the molecular formula C15H24O2
and a molecular weight of 236.35 g/mol. Its IUPAC name is 4-[3,3-dimethyl-2-(3-oxobutyl)cyclobutyl]pent-4-enal.
Molecular Properties
| Compound Name | 4-[3,3-dimethyl-2-(3-oxobutyl)cyclobutyl]pent-4-enal |
| PubChem CID | 89488063 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | 4-[3,3-dimethyl-2-(3-oxobutyl)cyclobutyl]pent-4-enal |
| SMILES | C=C(CCC=O)C1CC(C)(C)C1CCC(C)=O |
| InChI | InChI=1S/C15H24O2/c1-11(6-5-9-16)13-10-15(3,4)14(13)8-7-12(2)17/h9,13-14H,1,5-8,10H2,2-4H3 |
| InChIKey | PJJCDGMFEIUQRZ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-[3,3-dimethyl-2-(3-oxobutyl)cyclobutyl]pent-4-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3,3-dimethyl-2-(3-oxobutyl)cyclobutyl]pent-4-enal?
The IUPAC name of 4-[3,3-dimethyl-2-(3-oxobutyl)cyclobutyl]pent-4-enal (CID 89488063) is 4-[3,3-dimethyl-2-(3-oxobutyl)cyclobutyl]pent-4-enal.
What is the SMILES notation for 4-[3,3-dimethyl-2-(3-oxobutyl)cyclobutyl]pent-4-enal?
The canonical SMILES for 4-[3,3-dimethyl-2-(3-oxobutyl)cyclobutyl]pent-4-enal is C=C(CCC=O)C1CC(C)(C)C1CCC(C)=O.
What is the InChIKey of 4-[3,3-dimethyl-2-(3-oxobutyl)cyclobutyl]pent-4-enal?
The InChIKey is PJJCDGMFEIUQRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O2/c1-11(6-5-9-16)13-10-15(3,4)14(13)8-7-12(2)17/h9,13-14H,1,5-8,10H2,2-4H3.
What are the key properties of 4-[3,3-dimethyl-2-(3-oxobutyl)cyclobutyl]pent-4-enal?
4-[3,3-dimethyl-2-(3-oxobutyl)cyclobutyl]pent-4-enal has a molecular weight of 236.35 g/mol, XLogP of 3.55, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3,3-dimethyl-2-(3-oxobutyl)cyclobutyl]pent-4-enal is sourced from PubChem (CID 89488063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).