About 3-[[1-(2-chloro-1,3-thiazol-5-yl)-3-fluoropropan-2-yl]amino]-2H-furan-5-one
3-[[1-(2-chloro-1,3-thiazol-5-yl)-3-fluoropropan-2-yl]amino]-2H-furan-5-one (PubChem CID 89488266) has the molecular formula C10H10ClFN2O2S
and a molecular weight of 276.72 g/mol. Its IUPAC name is 3-[[1-(2-chloro-1,3-thiazol-5-yl)-3-fluoropropan-2-yl]amino]-2H-furan-5-one.
Molecular Properties
| Compound Name | 3-[[1-(2-chloro-1,3-thiazol-5-yl)-3-fluoropropan-2-yl]amino]-2H-furan-5-one |
| PubChem CID | 89488266 |
| Molecular Formula | C10H10ClFN2O2S |
| Molecular Weight | 276.72 g/mol |
| Exact Mass | 276.01 |
| IUPAC Name | 3-[[1-(2-chloro-1,3-thiazol-5-yl)-3-fluoropropan-2-yl]amino]-2H-furan-5-one |
| SMILES | O=C1C=C(NC(CF)Cc2cnc(Cl)s2)CO1 |
| InChI | InChI=1S/C10H10ClFN2O2S/c11-10-13-4-8(17-10)1-6(3-12)14-7-2-9(15)16-5-7/h2,4,6,14H,1,3,5H2 |
| InChIKey | ZSFQBYYZFMSMPQ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.72 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[[1-(2-chloro-1,3-thiazol-5-yl)-3-fluoropropan-2-yl]amino]-2H-furan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[1-(2-chloro-1,3-thiazol-5-yl)-3-fluoropropan-2-yl]amino]-2H-furan-5-one?
The IUPAC name of 3-[[1-(2-chloro-1,3-thiazol-5-yl)-3-fluoropropan-2-yl]amino]-2H-furan-5-one (CID 89488266) is 3-[[1-(2-chloro-1,3-thiazol-5-yl)-3-fluoropropan-2-yl]amino]-2H-furan-5-one.
What is the SMILES notation for 3-[[1-(2-chloro-1,3-thiazol-5-yl)-3-fluoropropan-2-yl]amino]-2H-furan-5-one?
The canonical SMILES for 3-[[1-(2-chloro-1,3-thiazol-5-yl)-3-fluoropropan-2-yl]amino]-2H-furan-5-one is O=C1C=C(NC(CF)Cc2cnc(Cl)s2)CO1.
What is the InChIKey of 3-[[1-(2-chloro-1,3-thiazol-5-yl)-3-fluoropropan-2-yl]amino]-2H-furan-5-one?
The InChIKey is ZSFQBYYZFMSMPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10ClFN2O2S/c11-10-13-4-8(17-10)1-6(3-12)14-7-2-9(15)16-5-7/h2,4,6,14H,1,3,5H2.
What are the key properties of 3-[[1-(2-chloro-1,3-thiazol-5-yl)-3-fluoropropan-2-yl]amino]-2H-furan-5-one?
3-[[1-(2-chloro-1,3-thiazol-5-yl)-3-fluoropropan-2-yl]amino]-2H-furan-5-one has a molecular weight of 276.72 g/mol, XLogP of 1.71, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[1-(2-chloro-1,3-thiazol-5-yl)-3-fluoropropan-2-yl]amino]-2H-furan-5-one is sourced from PubChem (CID 89488266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).