C21H26F2N4O3S — CID 89488720
(2R,3S,5R)-5-(1-cyclopentylsulfonyl-4,6-dihydropyrrolo[3,4-d]pyrazol-5-yl)-2-(2,5-difluorophenyl)oxan-3-amine (PubChem CID 89488720) has the molecular formula C21H26F2N4O3S and a molecular weight of 452.53 g/mol. Its IUPAC name is (2R,3S,5R)-5-(1-cyclopentylsulfonyl-4,6-dihydropyrrolo[3,4-d]pyrazol-5-yl)-2-(2,5-difluorophenyl)oxan-3-amine.
| Compound Name | (2R,3S,5R)-5-(1-cyclopentylsulfonyl-4,6-dihydropyrrolo[3,4-d]pyrazol-5-yl)-2-(2,5-difluorophenyl)oxan-3-amine |
|---|---|
| PubChem CID | 89488720 |
| Molecular Formula | C21H26F2N4O3S |
| Molecular Weight | 452.53 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | (2R,3S,5R)-5-(1-cyclopentylsulfonyl-4,6-dihydropyrrolo[3,4-d]pyrazol-5-yl)-2-(2,5-difluorophenyl)oxan-3-amine |
| SMILES | N[C@H]1C[C@@H](N2Cc3cnn(S(=O)(=O)C4CCCC4)c3C2)CO[C@@H]1c1cc(F)ccc1F |
| InChI | InChI=1S/C21H26F2N4O3S/c22-14-5-6-18(23)17(7-14)21-19(24)8-15(12-30-21)26-10-13-9-25-27(20(13)11-26)31(28,29)16-3-1-2-4-16/h5-7,9,15-16,19,21H,1-4,8,10-12,24H2/t15-,19+,21-/m1/s1 |
| InChIKey | OQYMNVVXGACVAN-MFMILTCTSA-N |
| XLogP | 2.45 |
| TPSA | 90.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.53 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |