About N'-(2,3-dimethoxypropyl)-N'-methylpropane-1,3-diamine
N'-(2,3-dimethoxypropyl)-N'-methylpropane-1,3-diamine (PubChem CID 89488905) has the molecular formula C9H22N2O2
and a molecular weight of 190.29 g/mol. Its IUPAC name is N'-(2,3-dimethoxypropyl)-N'-methylpropane-1,3-diamine.
Molecular Properties
| Compound Name | N'-(2,3-dimethoxypropyl)-N'-methylpropane-1,3-diamine |
| PubChem CID | 89488905 |
| Molecular Formula | C9H22N2O2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | N'-(2,3-dimethoxypropyl)-N'-methylpropane-1,3-diamine |
| SMILES | COCC(CN(C)CCCN)OC |
| InChI | InChI=1S/C9H22N2O2/c1-11(6-4-5-10)7-9(13-3)8-12-2/h9H,4-8,10H2,1-3H3 |
| InChIKey | HEDBJIWRUWUZIT-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N'-(2,3-dimethoxypropyl)-N'-methylpropane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2,3-dimethoxypropyl)-N'-methylpropane-1,3-diamine?
The IUPAC name of N'-(2,3-dimethoxypropyl)-N'-methylpropane-1,3-diamine (CID 89488905) is N'-(2,3-dimethoxypropyl)-N'-methylpropane-1,3-diamine.
What is the SMILES notation for N'-(2,3-dimethoxypropyl)-N'-methylpropane-1,3-diamine?
The canonical SMILES for N'-(2,3-dimethoxypropyl)-N'-methylpropane-1,3-diamine is COCC(CN(C)CCCN)OC.
What is the InChIKey of N'-(2,3-dimethoxypropyl)-N'-methylpropane-1,3-diamine?
The InChIKey is HEDBJIWRUWUZIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H22N2O2/c1-11(6-4-5-10)7-9(13-3)8-12-2/h9H,4-8,10H2,1-3H3.
What are the key properties of N'-(2,3-dimethoxypropyl)-N'-methylpropane-1,3-diamine?
N'-(2,3-dimethoxypropyl)-N'-methylpropane-1,3-diamine has a molecular weight of 190.29 g/mol, XLogP of -0.07, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2,3-dimethoxypropyl)-N'-methylpropane-1,3-diamine is sourced from PubChem (CID 89488905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).