C16H21NO4 — CID 89489140
[(1R,3R,8R,9R)-3-[(2R)-2-cyanopropyl]-2,7-dioxatricyclo[6.3.1.01,6]dodec-10-en-9-yl] acetate (PubChem CID 89489140) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is [(1R,3R,8R,9R)-3-[(2R)-2-cyanopropyl]-2,7-dioxatricyclo[6.3.1.01,6]dodec-10-en-9-yl] acetate.
| Compound Name | [(1R,3R,8R,9R)-3-[(2R)-2-cyanopropyl]-2,7-dioxatricyclo[6.3.1.01,6]dodec-10-en-9-yl] acetate |
|---|---|
| PubChem CID | 89489140 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | [(1R,3R,8R,9R)-3-[(2R)-2-cyanopropyl]-2,7-dioxatricyclo[6.3.1.01,6]dodec-10-en-9-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C=C[C@]23C[C@H]1OC2CC[C@H](CC(C)C#N)O3 |
| InChI | InChI=1S/C16H21NO4/c1-10(9-17)7-12-3-4-15-16(21-12)6-5-13(19-11(2)18)14(8-16)20-15/h5-6,10,12-15H,3-4,7-8H2,1-2H3/t10?,12-,13-,14-,15?,16+/m1/s1 |
| InChIKey | QQYKVZMDTOJFRJ-UUVRVEPNSA-N |
| XLogP | 2.11 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|