C15H21N3 — CID 89489153
2-[(1S)-1-(aminodiazenyl)-3-cyclohexa-2,4-dien-1-ylpropyl]cyclohexa-1,3-diene (PubChem CID 89489153) has the molecular formula C15H21N3 and a molecular weight of 243.35 g/mol. Its IUPAC name is 2-[(1S)-1-(aminodiazenyl)-3-cyclohexa-2,4-dien-1-ylpropyl]cyclohexa-1,3-diene.
| Compound Name | 2-[(1S)-1-(aminodiazenyl)-3-cyclohexa-2,4-dien-1-ylpropyl]cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 89489153 |
| Molecular Formula | C15H21N3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | 2-[(1S)-1-(aminodiazenyl)-3-cyclohexa-2,4-dien-1-ylpropyl]cyclohexa-1,3-diene |
| SMILES | N/N=N/[C@@H](CCC1C=CC=CC1)C1=CCCC=C1 |
| InChI | InChI=1S/C15H21N3/c16-18-17-15(14-9-5-2-6-10-14)12-11-13-7-3-1-4-8-13/h1,3-5,7,9-10,13,15H,2,6,8,11-12H2,(H2,16,17)/t13?,15-/m0/s1 |
| InChIKey | IBBAKTIQXLQRSU-WUJWULDRSA-N |
| XLogP | 3.87 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|