C14H19N3 — CID 89489154
2-[(2S)-2-(aminodiazenyl)-2-cyclohexa-2,4-dien-1-ylethyl]cyclohexa-1,3-diene (PubChem CID 89489154) has the molecular formula C14H19N3 and a molecular weight of 229.33 g/mol. Its IUPAC name is 2-[(2S)-2-(aminodiazenyl)-2-cyclohexa-2,4-dien-1-ylethyl]cyclohexa-1,3-diene.
| Compound Name | 2-[(2S)-2-(aminodiazenyl)-2-cyclohexa-2,4-dien-1-ylethyl]cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 89489154 |
| Molecular Formula | C14H19N3 |
| Molecular Weight | 229.33 g/mol |
| Exact Mass | 229.16 |
| IUPAC Name | 2-[(2S)-2-(aminodiazenyl)-2-cyclohexa-2,4-dien-1-ylethyl]cyclohexa-1,3-diene |
| SMILES | N/N=N/[C@@H](CC1=CCCC=C1)C1C=CC=CC1 |
| InChI | InChI=1S/C14H19N3/c15-17-16-14(13-9-5-2-6-10-13)11-12-7-3-1-4-8-12/h2-3,5-9,13-14H,1,4,10-11H2,(H2,15,16)/t13?,14-/m0/s1 |
| InChIKey | DPHPDAIFAXTKSL-KZUDCZAMSA-N |
| XLogP | 3.48 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.33 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|