C23H22Cl2F2N2O3 — CID 89489448
N-[4-(3,4-dichlorophenyl)butyl]-1-[2-(3,4-difluorophenyl)ethyl]-4-hydroxy-5-oxo-2H-pyrrole-3-carboxamide (PubChem CID 89489448) has the molecular formula C23H22Cl2F2N2O3 and a molecular weight of 483.34 g/mol. Its IUPAC name is N-[4-(3,4-dichlorophenyl)butyl]-1-[2-(3,4-difluorophenyl)ethyl]-4-hydroxy-5-oxo-2H-pyrrole-3-carboxamide.
| Compound Name | N-[4-(3,4-dichlorophenyl)butyl]-1-[2-(3,4-difluorophenyl)ethyl]-4-hydroxy-5-oxo-2H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 89489448 |
| Molecular Formula | C23H22Cl2F2N2O3 |
| Molecular Weight | 483.34 g/mol |
| Exact Mass | 482.10 |
| IUPAC Name | N-[4-(3,4-dichlorophenyl)butyl]-1-[2-(3,4-difluorophenyl)ethyl]-4-hydroxy-5-oxo-2H-pyrrole-3-carboxamide |
| SMILES | O=C(NCCCCc1ccc(Cl)c(Cl)c1)C1=C(O)C(=O)N(CCc2ccc(F)c(F)c2)C1 |
| InChI | InChI=1S/C23H22Cl2F2N2O3/c24-17-6-4-14(11-18(17)25)3-1-2-9-28-22(31)16-13-29(23(32)21(16)30)10-8-15-5-7-19(26)20(27)12-15/h4-7,11-12,30H,1-3,8-10,13H2,(H,28,31) |
| InChIKey | FVACGBYIQAHCKU-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.34 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|