C13H22O6 — CID 89489558
(5S,6S,7aR)-2-ethoxy-5,6,7-trimethoxy-3-methylidene-5,6,7,7a-tetrahydro-3aH-furo[3,2-b]pyran (PubChem CID 89489558) has the molecular formula C13H22O6 and a molecular weight of 274.31 g/mol. Its IUPAC name is (5S,6S,7aR)-2-ethoxy-5,6,7-trimethoxy-3-methylidene-5,6,7,7a-tetrahydro-3aH-furo[3,2-b]pyran.
| Compound Name | (5S,6S,7aR)-2-ethoxy-5,6,7-trimethoxy-3-methylidene-5,6,7,7a-tetrahydro-3aH-furo[3,2-b]pyran |
|---|---|
| PubChem CID | 89489558 |
| Molecular Formula | C13H22O6 |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | (5S,6S,7aR)-2-ethoxy-5,6,7-trimethoxy-3-methylidene-5,6,7,7a-tetrahydro-3aH-furo[3,2-b]pyran |
| SMILES | C=C1C(OCC)O[C@@H]2C1O[C@H](OC)[C@@H](OC)C2OC |
| InChI | InChI=1S/C13H22O6/c1-6-17-12-7(2)8-10(19-12)9(14-3)11(15-4)13(16-5)18-8/h8-13H,2,6H2,1,3-5H3/t8?,9?,10-,11+,12?,13+/m1/s1 |
| InChIKey | GGHRDOBMVKBBEJ-YZZYPOAGSA-N |
| XLogP | 0.71 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|