C20H23ClF3N5O3 — CID 89489883
3-[2-[[(1S)-1-[5-chloro-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethyl]amino]pyrimidin-4-yl]-4,4,5,5-tetramethyl-1,3-oxazolidin-2-one (PubChem CID 89489883) has the molecular formula C20H23ClF3N5O3 and a molecular weight of 473.88 g/mol. Its IUPAC name is 3-[2-[[(1S)-1-[5-chloro-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethyl]amino]pyrimidin-4-yl]-4,4,5,5-tetramethyl-1,3-oxazolidin-2-one.
| Compound Name | 3-[2-[[(1S)-1-[5-chloro-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethyl]amino]pyrimidin-4-yl]-4,4,5,5-tetramethyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 89489883 |
| Molecular Formula | C20H23ClF3N5O3 |
| Molecular Weight | 473.88 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | 3-[2-[[(1S)-1-[5-chloro-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethyl]amino]pyrimidin-4-yl]-4,4,5,5-tetramethyl-1,3-oxazolidin-2-one |
| SMILES | C[C@H](Nc1nccc(N2C(=O)OC(C)(C)C2(C)C)n1)c1cnc(OCC(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C20H23ClF3N5O3/c1-11(12-8-13(21)15(26-9-12)31-10-20(22,23)24)27-16-25-7-6-14(28-16)29-17(30)32-19(4,5)18(29,2)3/h6-9,11H,10H2,1-5H3,(H,25,27,28)/t11-/m0/s1 |
| InChIKey | JDKQLRZUJAPWKW-NSHDSACASA-N |
| XLogP | 5.15 |
| TPSA | 89.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.88 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |