C20H20ClFN6O3 — CID 89489908
3-[2-[[(1S)-1-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]amino]-5-fluoropyrimidin-4-yl]-4,4,5-trimethyl-1,3-oxazolidin-2-one (PubChem CID 89489908) has the molecular formula C20H20ClFN6O3 and a molecular weight of 446.87 g/mol. Its IUPAC name is 3-[2-[[(1S)-1-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]amino]-5-fluoropyrimidin-4-yl]-4,4,5-trimethyl-1,3-oxazolidin-2-one.
| Compound Name | 3-[2-[[(1S)-1-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]amino]-5-fluoropyrimidin-4-yl]-4,4,5-trimethyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 89489908 |
| Molecular Formula | C20H20ClFN6O3 |
| Molecular Weight | 446.87 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | 3-[2-[[(1S)-1-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]amino]-5-fluoropyrimidin-4-yl]-4,4,5-trimethyl-1,3-oxazolidin-2-one |
| SMILES | CC1OC(=O)N(c2nc(N[C@@H](C)c3nc(-c4ccc(Cl)cc4)no3)ncc2F)C1(C)C |
| InChI | InChI=1S/C20H20ClFN6O3/c1-10(17-25-15(27-31-17)12-5-7-13(21)8-6-12)24-18-23-9-14(22)16(26-18)28-19(29)30-11(2)20(28,3)4/h5-11H,1-4H3,(H,23,24,26)/t10-,11?/m0/s1 |
| InChIKey | NYTMZNISEVTUCT-VUWPPUDQSA-N |
| XLogP | 4.62 |
| TPSA | 106.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.87 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |