C28H33N5O2 — CID 89490065
(4R)-5,5-dimethyl-4-phenyl-3-[2-[1-(4-piperidin-1-ylphenyl)ethylamino]pyrimidin-4-yl]-1,3-oxazolidin-2-one (PubChem CID 89490065) has the molecular formula C28H33N5O2 and a molecular weight of 471.61 g/mol. Its IUPAC name is (4R)-5,5-dimethyl-4-phenyl-3-[2-[1-(4-piperidin-1-ylphenyl)ethylamino]pyrimidin-4-yl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-5,5-dimethyl-4-phenyl-3-[2-[1-(4-piperidin-1-ylphenyl)ethylamino]pyrimidin-4-yl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 89490065 |
| Molecular Formula | C28H33N5O2 |
| Molecular Weight | 471.61 g/mol |
| Exact Mass | 471.26 |
| IUPAC Name | (4R)-5,5-dimethyl-4-phenyl-3-[2-[1-(4-piperidin-1-ylphenyl)ethylamino]pyrimidin-4-yl]-1,3-oxazolidin-2-one |
| SMILES | CC(Nc1nccc(N2C(=O)OC(C)(C)[C@H]2c2ccccc2)n1)c1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C28H33N5O2/c1-20(21-12-14-23(15-13-21)32-18-8-5-9-19-32)30-26-29-17-16-24(31-26)33-25(22-10-6-4-7-11-22)28(2,3)35-27(33)34/h4,6-7,10-17,20,25H,5,8-9,18-19H2,1-3H3,(H,29,30,31)/t20?,25-/m1/s1 |
| InChIKey | DSEQOIQFYSICIW-GBAXHLBXSA-N |
| XLogP | 6.12 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.61 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|