C20H25NO5 — CID 8949039
[(2S)-1-oxo-1-(prop-2-enylamino)propan-2-yl] (E)-3-[(2S)-5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl]prop-2-enoate (PubChem CID 8949039) has the molecular formula C20H25NO5 and a molecular weight of 359.42 g/mol. Its IUPAC name is [(2S)-1-oxo-1-(prop-2-enylamino)propan-2-yl] (E)-3-[(2S)-5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl]prop-2-enoate.
| Compound Name | [(2S)-1-oxo-1-(prop-2-enylamino)propan-2-yl] (E)-3-[(2S)-5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl]prop-2-enoate |
|---|---|
| PubChem CID | 8949039 |
| Molecular Formula | C20H25NO5 |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | [(2S)-1-oxo-1-(prop-2-enylamino)propan-2-yl] (E)-3-[(2S)-5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl]prop-2-enoate |
| SMILES | C=CCNC(=O)[C@H](C)OC(=O)/C=C/c1cc2c(cc1OCC)C[C@H](C)O2 |
| InChI | InChI=1S/C20H25NO5/c1-5-9-21-20(23)14(4)26-19(22)8-7-15-11-18-16(10-13(3)25-18)12-17(15)24-6-2/h5,7-8,11-14H,1,6,9-10H2,2-4H3,(H,21,23)/b8-7+/t13-,14-/m0/s1 |
| InChIKey | PKKHBOCINQGKON-SWICKSTGSA-N |
| XLogP | 2.66 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|