C29H34Cl2N4O4S — CID 89491026
(2S,5R,6R)-4-[(1S)-2-tert-butylsulfonyl-1-cyclopropylethyl]-6-(3-chlorophenyl)-5-(4-chlorophenyl)-2-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]morpholin-3-one (PubChem CID 89491026) has the molecular formula C29H34Cl2N4O4S and a molecular weight of 605.59 g/mol. Its IUPAC name is (2S,5R,6R)-4-[(1S)-2-tert-butylsulfonyl-1-cyclopropylethyl]-6-(3-chlorophenyl)-5-(4-chlorophenyl)-2-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]morpholin-3-one.
| Compound Name | (2S,5R,6R)-4-[(1S)-2-tert-butylsulfonyl-1-cyclopropylethyl]-6-(3-chlorophenyl)-5-(4-chlorophenyl)-2-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]morpholin-3-one |
|---|---|
| PubChem CID | 89491026 |
| Molecular Formula | C29H34Cl2N4O4S |
| Molecular Weight | 605.59 g/mol |
| Exact Mass | 604.17 |
| IUPAC Name | (2S,5R,6R)-4-[(1S)-2-tert-butylsulfonyl-1-cyclopropylethyl]-6-(3-chlorophenyl)-5-(4-chlorophenyl)-2-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]morpholin-3-one |
| SMILES | Cc1nc(C[C@@H]2O[C@H](c3cccc(Cl)c3)[C@@H](c3ccc(Cl)cc3)N([C@H](CS(=O)(=O)C(C)(C)C)C3CC3)C2=O)n[nH]1 |
| InChI | InChI=1S/C29H34Cl2N4O4S/c1-17-32-25(34-33-17)15-24-28(36)35(23(18-8-9-18)16-40(37,38)29(2,3)4)26(19-10-12-21(30)13-11-19)27(39-24)20-6-5-7-22(31)14-20/h5-7,10-14,18,23-24,26-27H,8-9,15-16H2,1-4H3,(H,32,33,34)/t23-,24+,26-,27-/m1/s1 |
| InChIKey | VPVXIOSBTACJCZ-NLXKVGEISA-N |
| XLogP | 5.66 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.59 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |