C20H15BrF2N2O3 — CID 89491207
N-(1-bromo-7,8-dihydroisoquinolin-3-yl)-1-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclopropane-1-carboxamide (PubChem CID 89491207) has the molecular formula C20H15BrF2N2O3 and a molecular weight of 449.25 g/mol. Its IUPAC name is N-(1-bromo-7,8-dihydroisoquinolin-3-yl)-1-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclopropane-1-carboxamide.
| Compound Name | N-(1-bromo-7,8-dihydroisoquinolin-3-yl)-1-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 89491207 |
| Molecular Formula | C20H15BrF2N2O3 |
| Molecular Weight | 449.25 g/mol |
| Exact Mass | 448.02 |
| IUPAC Name | N-(1-bromo-7,8-dihydroisoquinolin-3-yl)-1-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclopropane-1-carboxamide |
| SMILES | O=C(Nc1cc2c(c(Br)n1)CCC=C2)C1(c2ccc3c(c2)OC(F)(F)O3)CC1 |
| InChI | InChI=1S/C20H15BrF2N2O3/c21-17-13-4-2-1-3-11(13)9-16(24-17)25-18(26)19(7-8-19)12-5-6-14-15(10-12)28-20(22,23)27-14/h1,3,5-6,9-10H,2,4,7-8H2,(H,24,25,26) |
| InChIKey | SRSWEDZSENZNAT-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.25 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|