C35H45N3O2S2 — CID 89491487
(5Z)-3-(2-adamantyl)-5-[[5-(3-methoxyphenyl)-3-(5-piperidin-1-ylpentyl)-1H-pyrrol-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 89491487) has the molecular formula C35H45N3O2S2 and a molecular weight of 603.90 g/mol. Its IUPAC name is (5Z)-3-(2-adamantyl)-5-[[5-(3-methoxyphenyl)-3-(5-piperidin-1-ylpentyl)-1H-pyrrol-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-(2-adamantyl)-5-[[5-(3-methoxyphenyl)-3-(5-piperidin-1-ylpentyl)-1H-pyrrol-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 89491487 |
| Molecular Formula | C35H45N3O2S2 |
| Molecular Weight | 603.90 g/mol |
| Exact Mass | 603.30 |
| IUPAC Name | (5Z)-3-(2-adamantyl)-5-[[5-(3-methoxyphenyl)-3-(5-piperidin-1-ylpentyl)-1H-pyrrol-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | COc1cccc(-c2cc(CCCCCN3CCCCC3)c(/C=C3\SC(=S)N(C4C5CC6CC(C5)CC4C6)C3=O)[nH]2)c1 |
| InChI | InChI=1S/C35H45N3O2S2/c1-40-29-11-8-10-25(20-29)30-21-26(9-4-2-5-12-37-13-6-3-7-14-37)31(36-30)22-32-34(39)38(35(41)42-32)33-27-16-23-15-24(18-27)19-28(33)17-23/h8,10-11,20-24,27-28,33,36H,2-7,9,12-19H2,1H3/b32-22- |
| InChIKey | MOJBJYCWANFNTC-JDCMOKTRSA-N |
| XLogP | 7.91 |
| TPSA | 48.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.90 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|