C32H41N3O4S2 — CID 89491669
(5Z)-3-(2-bicyclo[2.2.1]heptanyl)-5-[[5-(3,5-dimethoxyphenyl)-3-(5-piperazin-1-ylpentyl)furan-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 89491669) has the molecular formula C32H41N3O4S2 and a molecular weight of 595.83 g/mol. Its IUPAC name is (5Z)-3-(2-bicyclo[2.2.1]heptanyl)-5-[[5-(3,5-dimethoxyphenyl)-3-(5-piperazin-1-ylpentyl)furan-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-(2-bicyclo[2.2.1]heptanyl)-5-[[5-(3,5-dimethoxyphenyl)-3-(5-piperazin-1-ylpentyl)furan-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 89491669 |
| Molecular Formula | C32H41N3O4S2 |
| Molecular Weight | 595.83 g/mol |
| Exact Mass | 595.25 |
| IUPAC Name | (5Z)-3-(2-bicyclo[2.2.1]heptanyl)-5-[[5-(3,5-dimethoxyphenyl)-3-(5-piperazin-1-ylpentyl)furan-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | COc1cc(OC)cc(-c2cc(CCCCCN3CCNCC3)c(/C=C3\SC(=S)N(C4CC5CCC4C5)C3=O)o2)c1 |
| InChI | InChI=1S/C32H41N3O4S2/c1-37-25-16-24(17-26(19-25)38-2)28-18-23(6-4-3-5-11-34-12-9-33-10-13-34)29(39-28)20-30-31(36)35(32(40)41-30)27-15-21-7-8-22(27)14-21/h16-22,27,33H,3-15H2,1-2H3/b30-20- |
| InChIKey | NGTRMDVVUGDYEI-COEJQBHMSA-N |
| XLogP | 5.97 |
| TPSA | 67.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.83 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|