About 5-[(2,6-difluorophenyl)methoxymethyl]-5-methyl-3-[2-(trifluoromethyl)phenyl]-4H-1,2-oxazole
5-[(2,6-difluorophenyl)methoxymethyl]-5-methyl-3-[2-(trifluoromethyl)phenyl]-4H-1,2-oxazole (PubChem CID 89491855) has the molecular formula C19H16F5NO2
and a molecular weight of 385.33 g/mol. Its IUPAC name is 5-[(2,6-difluorophenyl)methoxymethyl]-5-methyl-3-[2-(trifluoromethyl)phenyl]-4H-1,2-oxazole.
Molecular Properties
| Compound Name | 5-[(2,6-difluorophenyl)methoxymethyl]-5-methyl-3-[2-(trifluoromethyl)phenyl]-4H-1,2-oxazole |
| PubChem CID | 89491855 |
| Molecular Formula | C19H16F5NO2 |
| Molecular Weight | 385.33 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | 5-[(2,6-difluorophenyl)methoxymethyl]-5-methyl-3-[2-(trifluoromethyl)phenyl]-4H-1,2-oxazole |
| SMILES | CC1(COCc2c(F)cccc2F)CC(c2ccccc2C(F)(F)F)=NO1 |
| InChI | InChI=1S/C19H16F5NO2/c1-18(11-26-10-13-15(20)7-4-8-16(13)21)9-17(25-27-18)12-5-2-3-6-14(12)19(22,23)24/h2-8H,9-11H2,1H3 |
| InChIKey | BOUPZEDHVSVMGM-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 385.33 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[(2,6-difluorophenyl)methoxymethyl]-5-methyl-3-[2-(trifluoromethyl)phenyl]-4H-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2,6-difluorophenyl)methoxymethyl]-5-methyl-3-[2-(trifluoromethyl)phenyl]-4H-1,2-oxazole?
The IUPAC name of 5-[(2,6-difluorophenyl)methoxymethyl]-5-methyl-3-[2-(trifluoromethyl)phenyl]-4H-1,2-oxazole (CID 89491855) is 5-[(2,6-difluorophenyl)methoxymethyl]-5-methyl-3-[2-(trifluoromethyl)phenyl]-4H-1,2-oxazole.
What is the SMILES notation for 5-[(2,6-difluorophenyl)methoxymethyl]-5-methyl-3-[2-(trifluoromethyl)phenyl]-4H-1,2-oxazole?
The canonical SMILES for 5-[(2,6-difluorophenyl)methoxymethyl]-5-methyl-3-[2-(trifluoromethyl)phenyl]-4H-1,2-oxazole is CC1(COCc2c(F)cccc2F)CC(c2ccccc2C(F)(F)F)=NO1.
What is the InChIKey of 5-[(2,6-difluorophenyl)methoxymethyl]-5-methyl-3-[2-(trifluoromethyl)phenyl]-4H-1,2-oxazole?
The InChIKey is BOUPZEDHVSVMGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16F5NO2/c1-18(11-26-10-13-15(20)7-4-8-16(13)21)9-17(25-27-18)12-5-2-3-6-14(12)19(22,23)24/h2-8H,9-11H2,1H3.
What are the key properties of 5-[(2,6-difluorophenyl)methoxymethyl]-5-methyl-3-[2-(trifluoromethyl)phenyl]-4H-1,2-oxazole?
5-[(2,6-difluorophenyl)methoxymethyl]-5-methyl-3-[2-(trifluoromethyl)phenyl]-4H-1,2-oxazole has a molecular weight of 385.33 g/mol, XLogP of 5.08, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2,6-difluorophenyl)methoxymethyl]-5-methyl-3-[2-(trifluoromethyl)phenyl]-4H-1,2-oxazole is sourced from PubChem (CID 89491855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).