About 2-phenyl-5-[(3S,6R)-6-phenylpiperidin-3-yl]-4-pyridin-4-yl-1,3-oxazole
2-phenyl-5-[(3S,6R)-6-phenylpiperidin-3-yl]-4-pyridin-4-yl-1,3-oxazole (PubChem CID 89492373) has the molecular formula C25H23N3O
and a molecular weight of 381.48 g/mol. Its IUPAC name is 2-phenyl-5-[(3S,6R)-6-phenylpiperidin-3-yl]-4-pyridin-4-yl-1,3-oxazole.
Molecular Properties
| Compound Name | 2-phenyl-5-[(3S,6R)-6-phenylpiperidin-3-yl]-4-pyridin-4-yl-1,3-oxazole |
| PubChem CID | 89492373 |
| Molecular Formula | C25H23N3O |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | 2-phenyl-5-[(3S,6R)-6-phenylpiperidin-3-yl]-4-pyridin-4-yl-1,3-oxazole |
| SMILES | c1ccc(-c2nc(-c3ccncc3)c([C@H]3CC[C@H](c4ccccc4)NC3)o2)cc1 |
| InChI | InChI=1S/C25H23N3O/c1-3-7-18(8-4-1)22-12-11-21(17-27-22)24-23(19-13-15-26-16-14-19)28-25(29-24)20-9-5-2-6-10-20/h1-10,13-16,21-22,27H,11-12,17H2/t21-,22+/m0/s1 |
| InChIKey | TWMBNPCRYUBAJF-FCHUYYIVSA-N |
| XLogP | 5.61 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-phenyl-5-[(3S,6R)-6-phenylpiperidin-3-yl]-4-pyridin-4-yl-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-5-[(3S,6R)-6-phenylpiperidin-3-yl]-4-pyridin-4-yl-1,3-oxazole?
The IUPAC name of 2-phenyl-5-[(3S,6R)-6-phenylpiperidin-3-yl]-4-pyridin-4-yl-1,3-oxazole (CID 89492373) is 2-phenyl-5-[(3S,6R)-6-phenylpiperidin-3-yl]-4-pyridin-4-yl-1,3-oxazole.
What is the SMILES notation for 2-phenyl-5-[(3S,6R)-6-phenylpiperidin-3-yl]-4-pyridin-4-yl-1,3-oxazole?
The canonical SMILES for 2-phenyl-5-[(3S,6R)-6-phenylpiperidin-3-yl]-4-pyridin-4-yl-1,3-oxazole is c1ccc(-c2nc(-c3ccncc3)c([C@H]3CC[C@H](c4ccccc4)NC3)o2)cc1.
What is the InChIKey of 2-phenyl-5-[(3S,6R)-6-phenylpiperidin-3-yl]-4-pyridin-4-yl-1,3-oxazole?
The InChIKey is TWMBNPCRYUBAJF-FCHUYYIVSA-N. The full InChI is InChI=1S/C25H23N3O/c1-3-7-18(8-4-1)22-12-11-21(17-27-22)24-23(19-13-15-26-16-14-19)28-25(29-24)20-9-5-2-6-10-20/h1-10,13-16,21-22,27H,11-12,17H2/t21-,22+/m0/s1.
What are the key properties of 2-phenyl-5-[(3S,6R)-6-phenylpiperidin-3-yl]-4-pyridin-4-yl-1,3-oxazole?
2-phenyl-5-[(3S,6R)-6-phenylpiperidin-3-yl]-4-pyridin-4-yl-1,3-oxazole has a molecular weight of 381.48 g/mol, XLogP of 5.61, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-5-[(3S,6R)-6-phenylpiperidin-3-yl]-4-pyridin-4-yl-1,3-oxazole is sourced from PubChem (CID 89492373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).