C37H36F3NO4S — CID 89492701
2-[[5-[(2S,3R,4S,5R,6R)-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)oxan-2-yl]-2-(trifluoromethyl)phenyl]methyl]-5-(furan-2-yl)-1,3-thiazole (PubChem CID 89492701) has the molecular formula C37H36F3NO4S and a molecular weight of 647.76 g/mol. Its IUPAC name is 2-[[5-[(2S,3R,4S,5R,6R)-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)oxan-2-yl]-2-(trifluoromethyl)phenyl]methyl]-5-(furan-2-yl)-1,3-thiazole.
| Compound Name | 2-[[5-[(2S,3R,4S,5R,6R)-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)oxan-2-yl]-2-(trifluoromethyl)phenyl]methyl]-5-(furan-2-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 89492701 |
| Molecular Formula | C37H36F3NO4S |
| Molecular Weight | 647.76 g/mol |
| Exact Mass | 647.23 |
| IUPAC Name | 2-[[5-[(2S,3R,4S,5R,6R)-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)oxan-2-yl]-2-(trifluoromethyl)phenyl]methyl]-5-(furan-2-yl)-1,3-thiazole |
| SMILES | CC[C@H]1O[C@@H](c2ccc(C(F)(F)F)c(Cc3ncc(-c4ccco4)s3)c2)C(OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1C |
| InChI | InChI=1S/C37H36F3NO4S/c1-3-30-24(2)34(43-22-25-11-6-4-7-12-25)36(44-23-26-13-8-5-9-14-26)35(45-30)27-16-17-29(37(38,39)40)28(19-27)20-33-41-21-32(46-33)31-15-10-18-42-31/h4-19,21,24,30,34-36H,3,20,22-23H2,1-2H3/t24-,30-,34+,35+,36?/m1/s1 |
| InChIKey | GVJGHCNBIKXWKH-WKXJQCHFSA-N |
| XLogP | 9.67 |
| TPSA | 53.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.76 |
| LogP ≤ 5 | 9.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |