About [1-[(4R)-4-amino-7-hydroxyheptyl]-2-oxo-1,3-diazinan-4-yl]urea
[1-[(4R)-4-amino-7-hydroxyheptyl]-2-oxo-1,3-diazinan-4-yl]urea (PubChem CID 89492744) has the molecular formula C12H25N5O3
and a molecular weight of 287.36 g/mol. Its IUPAC name is [1-[(4R)-4-amino-7-hydroxyheptyl]-2-oxo-1,3-diazinan-4-yl]urea.
Molecular Properties
| Compound Name | [1-[(4R)-4-amino-7-hydroxyheptyl]-2-oxo-1,3-diazinan-4-yl]urea |
| PubChem CID | 89492744 |
| Molecular Formula | C12H25N5O3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | [1-[(4R)-4-amino-7-hydroxyheptyl]-2-oxo-1,3-diazinan-4-yl]urea |
| SMILES | NC(=O)NC1CCN(CCC[C@@H](N)CCCO)C(=O)N1 |
| InChI | InChI=1S/C12H25N5O3/c13-9(4-2-8-18)3-1-6-17-7-5-10(15-11(14)19)16-12(17)20/h9-10,18H,1-8,13H2,(H,16,20)(H3,14,15,19)/t9-,10?/m1/s1 |
| InChIKey | DBUKQDMWGWNJIT-YHMJZVADSA-N |
| XLogP | -0.72 |
| TPSA | 133.71 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1-[(4R)-4-amino-7-hydroxyheptyl]-2-oxo-1,3-diazinan-4-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(4R)-4-amino-7-hydroxyheptyl]-2-oxo-1,3-diazinan-4-yl]urea?
The IUPAC name of [1-[(4R)-4-amino-7-hydroxyheptyl]-2-oxo-1,3-diazinan-4-yl]urea (CID 89492744) is [1-[(4R)-4-amino-7-hydroxyheptyl]-2-oxo-1,3-diazinan-4-yl]urea.
What is the SMILES notation for [1-[(4R)-4-amino-7-hydroxyheptyl]-2-oxo-1,3-diazinan-4-yl]urea?
The canonical SMILES for [1-[(4R)-4-amino-7-hydroxyheptyl]-2-oxo-1,3-diazinan-4-yl]urea is NC(=O)NC1CCN(CCC[C@@H](N)CCCO)C(=O)N1.
What is the InChIKey of [1-[(4R)-4-amino-7-hydroxyheptyl]-2-oxo-1,3-diazinan-4-yl]urea?
The InChIKey is DBUKQDMWGWNJIT-YHMJZVADSA-N. The full InChI is InChI=1S/C12H25N5O3/c13-9(4-2-8-18)3-1-6-17-7-5-10(15-11(14)19)16-12(17)20/h9-10,18H,1-8,13H2,(H,16,20)(H3,14,15,19)/t9-,10?/m1/s1.
What are the key properties of [1-[(4R)-4-amino-7-hydroxyheptyl]-2-oxo-1,3-diazinan-4-yl]urea?
[1-[(4R)-4-amino-7-hydroxyheptyl]-2-oxo-1,3-diazinan-4-yl]urea has a molecular weight of 287.36 g/mol, XLogP of -0.72, 8 rotatable bonds, 5 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(4R)-4-amino-7-hydroxyheptyl]-2-oxo-1,3-diazinan-4-yl]urea is sourced from PubChem (CID 89492744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).