C14H30N4O — CID 89492883
1-[(3R)-1-[(2S)-3-amino-2-methylpropyl]piperidin-3-yl]-3-tert-butylurea (PubChem CID 89492883) has the molecular formula C14H30N4O and a molecular weight of 270.42 g/mol. Its IUPAC name is 1-[(3R)-1-[(2S)-3-amino-2-methylpropyl]piperidin-3-yl]-3-tert-butylurea.
| Compound Name | 1-[(3R)-1-[(2S)-3-amino-2-methylpropyl]piperidin-3-yl]-3-tert-butylurea |
|---|---|
| PubChem CID | 89492883 |
| Molecular Formula | C14H30N4O |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.24 |
| IUPAC Name | 1-[(3R)-1-[(2S)-3-amino-2-methylpropyl]piperidin-3-yl]-3-tert-butylurea |
| SMILES | C[C@@H](CN)CN1CCC[C@@H](NC(=O)NC(C)(C)C)C1 |
| InChI | InChI=1S/C14H30N4O/c1-11(8-15)9-18-7-5-6-12(10-18)16-13(19)17-14(2,3)4/h11-12H,5-10,15H2,1-4H3,(H2,16,17,19)/t11-,12+/m0/s1 |
| InChIKey | CSQLZMDJHOHOFK-NWDGAFQWSA-N |
| XLogP | 1.14 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |