C12H21N3 — CID 89493049
(Z)-N'-methyl-N-(1,2,3,6-tetrahydropyridin-2-yl)hex-4-enimidamide (PubChem CID 89493049) has the molecular formula C12H21N3 and a molecular weight of 207.32 g/mol. Its IUPAC name is (Z)-N'-methyl-N-(1,2,3,6-tetrahydropyridin-2-yl)hex-4-enimidamide.
| Compound Name | (Z)-N'-methyl-N-(1,2,3,6-tetrahydropyridin-2-yl)hex-4-enimidamide |
|---|---|
| PubChem CID | 89493049 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | (Z)-N'-methyl-N-(1,2,3,6-tetrahydropyridin-2-yl)hex-4-enimidamide |
| SMILES | C/C=C\CC/C(=N\C)NC1CC=CCN1 |
| InChI | InChI=1S/C12H21N3/c1-3-4-5-8-11(13-2)15-12-9-6-7-10-14-12/h3-4,6-7,12,14H,5,8-10H2,1-2H3,(H,13,15)/b4-3- |
| InChIKey | ZNNPUXWBWAZQPQ-ARJAWSKDSA-N |
| XLogP | 1.84 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|