About N-[6-(2,2-difluoro-2-phenylethoxy)hexyl]-1-phenylmethanimine
N-[6-(2,2-difluoro-2-phenylethoxy)hexyl]-1-phenylmethanimine (PubChem CID 89493055) has the molecular formula C21H25F2NO
and a molecular weight of 345.43 g/mol. Its IUPAC name is N-[6-(2,2-difluoro-2-phenylethoxy)hexyl]-1-phenylmethanimine.
Molecular Properties
| Compound Name | N-[6-(2,2-difluoro-2-phenylethoxy)hexyl]-1-phenylmethanimine |
| PubChem CID | 89493055 |
| Molecular Formula | C21H25F2NO |
| Molecular Weight | 345.43 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | N-[6-(2,2-difluoro-2-phenylethoxy)hexyl]-1-phenylmethanimine |
| SMILES | FC(F)(COCCCCCC/N=C/c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H25F2NO/c22-21(23,20-13-7-4-8-14-20)18-25-16-10-2-1-9-15-24-17-19-11-5-3-6-12-19/h3-8,11-14,17H,1-2,9-10,15-16,18H2/b24-17+ |
| InChIKey | RMISGWIUVLADHB-JJIBRWJFSA-N |
| XLogP | 5.47 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 345.43 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-[6-(2,2-difluoro-2-phenylethoxy)hexyl]-1-phenylmethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[6-(2,2-difluoro-2-phenylethoxy)hexyl]-1-phenylmethanimine?
The IUPAC name of N-[6-(2,2-difluoro-2-phenylethoxy)hexyl]-1-phenylmethanimine (CID 89493055) is N-[6-(2,2-difluoro-2-phenylethoxy)hexyl]-1-phenylmethanimine.
What is the SMILES notation for N-[6-(2,2-difluoro-2-phenylethoxy)hexyl]-1-phenylmethanimine?
The canonical SMILES for N-[6-(2,2-difluoro-2-phenylethoxy)hexyl]-1-phenylmethanimine is FC(F)(COCCCCCC/N=C/c1ccccc1)c1ccccc1.
What is the InChIKey of N-[6-(2,2-difluoro-2-phenylethoxy)hexyl]-1-phenylmethanimine?
The InChIKey is RMISGWIUVLADHB-JJIBRWJFSA-N. The full InChI is InChI=1S/C21H25F2NO/c22-21(23,20-13-7-4-8-14-20)18-25-16-10-2-1-9-15-24-17-19-11-5-3-6-12-19/h3-8,11-14,17H,1-2,9-10,15-16,18H2/b24-17+.
What are the key properties of N-[6-(2,2-difluoro-2-phenylethoxy)hexyl]-1-phenylmethanimine?
N-[6-(2,2-difluoro-2-phenylethoxy)hexyl]-1-phenylmethanimine has a molecular weight of 345.43 g/mol, XLogP of 5.47, 11 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[6-(2,2-difluoro-2-phenylethoxy)hexyl]-1-phenylmethanimine is sourced from PubChem (CID 89493055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).