C12H14N2 — CID 89493066
1,2,4a,8,9,10b-hexahydro-1,10-phenanthroline (PubChem CID 89493066) has the molecular formula C12H14N2 and a molecular weight of 186.26 g/mol. Its IUPAC name is 1,2,4a,8,9,10b-hexahydro-1,10-phenanthroline.
| Compound Name | 1,2,4a,8,9,10b-hexahydro-1,10-phenanthroline |
|---|---|
| PubChem CID | 89493066 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 1,2,4a,8,9,10b-hexahydro-1,10-phenanthroline |
| SMILES | C1=CC2C=CC3=CCCN=C3C2NC1 |
| InChI | InChI=1S/C12H14N2/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1/h1,3-6,9,11,13H,2,7-8H2 |
| InChIKey | NFBATTOLJPQDQG-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|