C9H13N7S — CID 89493168
(8R)-8-methyl-3-(3-methyl-1,2,4-thiadiazol-5-yl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-amine (PubChem CID 89493168) has the molecular formula C9H13N7S and a molecular weight of 251.32 g/mol. Its IUPAC name is (8R)-8-methyl-3-(3-methyl-1,2,4-thiadiazol-5-yl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-amine.
| Compound Name | (8R)-8-methyl-3-(3-methyl-1,2,4-thiadiazol-5-yl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-amine |
|---|---|
| PubChem CID | 89493168 |
| Molecular Formula | C9H13N7S |
| Molecular Weight | 251.32 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | (8R)-8-methyl-3-(3-methyl-1,2,4-thiadiazol-5-yl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-amine |
| SMILES | Cc1nsc(-c2nnc3n2CCN(N)[C@@H]3C)n1 |
| InChI | InChI=1S/C9H13N7S/c1-5-7-12-13-8(9-11-6(2)14-17-9)15(7)3-4-16(5)10/h5H,3-4,10H2,1-2H3/t5-/m1/s1 |
| InChIKey | UPJRGIOHUFLHRR-RXMQYKEDSA-N |
| XLogP | 0.36 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.32 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|