C10H13N5S — CID 89493217
4-methyl-2-[(8R)-8-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl]-1,3-thiazole (PubChem CID 89493217) has the molecular formula C10H13N5S and a molecular weight of 235.32 g/mol. Its IUPAC name is 4-methyl-2-[(8R)-8-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl]-1,3-thiazole.
| Compound Name | 4-methyl-2-[(8R)-8-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 89493217 |
| Molecular Formula | C10H13N5S |
| Molecular Weight | 235.32 g/mol |
| Exact Mass | 235.09 |
| IUPAC Name | 4-methyl-2-[(8R)-8-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl]-1,3-thiazole |
| SMILES | Cc1csc(-c2nnc3n2CCN[C@@H]3C)n1 |
| InChI | InChI=1S/C10H13N5S/c1-6-5-16-10(12-6)9-14-13-8-7(2)11-3-4-15(8)9/h5,7,11H,3-4H2,1-2H3/t7-/m1/s1 |
| InChIKey | AKIBBMUXIUBRAY-SSDOTTSWSA-N |
| XLogP | 1.37 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.32 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |