C26H29NO6S2 — CID 89493612
2-[4-[(3-cyclohexyl-4-ethoxyphenyl)sulfonylamino]-1-hydroxynaphthalen-2-yl]sulfanylacetic acid (PubChem CID 89493612) has the molecular formula C26H29NO6S2 and a molecular weight of 515.65 g/mol. Its IUPAC name is 2-[4-[(3-cyclohexyl-4-ethoxyphenyl)sulfonylamino]-1-hydroxynaphthalen-2-yl]sulfanylacetic acid.
| Compound Name | 2-[4-[(3-cyclohexyl-4-ethoxyphenyl)sulfonylamino]-1-hydroxynaphthalen-2-yl]sulfanylacetic acid |
|---|---|
| PubChem CID | 89493612 |
| Molecular Formula | C26H29NO6S2 |
| Molecular Weight | 515.65 g/mol |
| Exact Mass | 515.14 |
| IUPAC Name | 2-[4-[(3-cyclohexyl-4-ethoxyphenyl)sulfonylamino]-1-hydroxynaphthalen-2-yl]sulfanylacetic acid |
| SMILES | CCOc1ccc(S(=O)(=O)Nc2cc(SCC(=O)O)c(O)c3ccccc23)cc1C1CCCCC1 |
| InChI | InChI=1S/C26H29NO6S2/c1-2-33-23-13-12-18(14-21(23)17-8-4-3-5-9-17)35(31,32)27-22-15-24(34-16-25(28)29)26(30)20-11-7-6-10-19(20)22/h6-7,10-15,17,27,30H,2-5,8-9,16H2,1H3,(H,28,29) |
| InChIKey | OCAUFBLWIXRWSJ-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.65 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|